C23H20Cl3N3O — CID 5156350
12,15,15-trimethyl-N-(2,4,5-trichlorophenyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide (PubChem CID 5156350) has the molecular formula C23H20Cl3N3O and a molecular weight of 460.79 g/mol. Its IUPAC name is 12,15,15-trimethyl-N-(2,4,5-trichlorophenyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide.
| Compound Name | 12,15,15-trimethyl-N-(2,4,5-trichlorophenyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide |
|---|---|
| PubChem CID | 5156350 |
| Molecular Formula | C23H20Cl3N3O |
| Molecular Weight | 460.79 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 12,15,15-trimethyl-N-(2,4,5-trichlorophenyl)-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxamide |
| SMILES | CC12CCC(C(=O)Nc3cc(Cl)c(Cl)cc3Cl)(c3nc4ccccc4nc31)C2(C)C |
| InChI | InChI=1S/C23H20Cl3N3O/c1-21(2)22(3)8-9-23(21,19-18(22)27-15-6-4-5-7-16(15)28-19)20(30)29-17-11-13(25)12(24)10-14(17)26/h4-7,10-11H,8-9H2,1-3H3,(H,29,30) |
| InChIKey | YUBGMCSCWBDESW-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.79 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|