C27H30N4O — CID 51563584
(4R)-4-[bis[4-(dimethylamino)phenyl]methyl]-5-methyl-2-phenyl-4H-pyrazol-3-one (PubChem CID 51563584) has the molecular formula C27H30N4O and a molecular weight of 426.56 g/mol. Its IUPAC name is (4R)-4-[bis[4-(dimethylamino)phenyl]methyl]-5-methyl-2-phenyl-4H-pyrazol-3-one.
| Compound Name | (4R)-4-[bis[4-(dimethylamino)phenyl]methyl]-5-methyl-2-phenyl-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 51563584 |
| Molecular Formula | C27H30N4O |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | (4R)-4-[bis[4-(dimethylamino)phenyl]methyl]-5-methyl-2-phenyl-4H-pyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)[C@@H]1C(c1ccc(N(C)C)cc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C27H30N4O/c1-19-25(27(32)31(28-19)24-9-7-6-8-10-24)26(20-11-15-22(16-12-20)29(2)3)21-13-17-23(18-14-21)30(4)5/h6-18,25-26H,1-5H3/t25-/m0/s1 |
| InChIKey | TWBVNCGGUAANMN-VWLOTQADSA-N |
| XLogP | 4.99 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|