C24H33N3O3 — CID 51565159
2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N,N-dicyclohexylacetamide (PubChem CID 51565159) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N,N-dicyclohexylacetamide.
| Compound Name | 2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N,N-dicyclohexylacetamide |
|---|---|
| PubChem CID | 51565159 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 2-[(4R)-4-benzyl-2,5-dioxoimidazolidin-1-yl]-N,N-dicyclohexylacetamide |
| SMILES | O=C1N[C@H](Cc2ccccc2)C(=O)N1CC(=O)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C24H33N3O3/c28-22(27(19-12-6-2-7-13-19)20-14-8-3-9-15-20)17-26-23(29)21(25-24(26)30)16-18-10-4-1-5-11-18/h1,4-5,10-11,19-21H,2-3,6-9,12-17H2,(H,25,30)/t21-/m1/s1 |
| InChIKey | YAOWTNYCPATVHF-OAQYLSRUSA-N |
| XLogP | 3.64 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|