About bis[3-(diethylamino)propyl] fluoranthene-3,9-dicarboxylate
bis[3-(diethylamino)propyl] fluoranthene-3,9-dicarboxylate (PubChem CID 515653) has the molecular formula C32H40N2O4
and a molecular weight of 516.68 g/mol. Its IUPAC name is bis[3-(diethylamino)propyl] fluoranthene-3,9-dicarboxylate.
Molecular Properties
| Compound Name | bis[3-(diethylamino)propyl] fluoranthene-3,9-dicarboxylate |
| PubChem CID | 515653 |
| Molecular Formula | C32H40N2O4 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | bis[3-(diethylamino)propyl] fluoranthene-3,9-dicarboxylate |
| SMILES | CCN(CC)CCCOC(=O)c1ccc2c(c1)-c1ccc(C(=O)OCCCN(CC)CC)c3cccc-2c13 |
| InChI | InChI=1S/C32H40N2O4/c1-5-33(6-2)18-10-20-37-31(35)23-14-15-24-25-12-9-13-26-28(17-16-27(30(25)26)29(24)22-23)32(36)38-21-11-19-34(7-3)8-4/h9,12-17,22H,5-8,10-11,18-21H2,1-4H3 |
| InChIKey | DOWUOKXGWVHVGF-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis[3-(diethylamino)propyl] fluoranthene-3,9-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[3-(diethylamino)propyl] fluoranthene-3,9-dicarboxylate?
The IUPAC name of bis[3-(diethylamino)propyl] fluoranthene-3,9-dicarboxylate (CID 515653) is bis[3-(diethylamino)propyl] fluoranthene-3,9-dicarboxylate.
What is the SMILES notation for bis[3-(diethylamino)propyl] fluoranthene-3,9-dicarboxylate?
The canonical SMILES for bis[3-(diethylamino)propyl] fluoranthene-3,9-dicarboxylate is CCN(CC)CCCOC(=O)c1ccc2c(c1)-c1ccc(C(=O)OCCCN(CC)CC)c3cccc-2c13.
What is the InChIKey of bis[3-(diethylamino)propyl] fluoranthene-3,9-dicarboxylate?
The InChIKey is DOWUOKXGWVHVGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H40N2O4/c1-5-33(6-2)18-10-20-37-31(35)23-14-15-24-25-12-9-13-26-28(17-16-27(30(25)26)29(24)22-23)32(36)38-21-11-19-34(7-3)8-4/h9,12-17,22H,5-8,10-11,18-21H2,1-4H3.
What are the key properties of bis[3-(diethylamino)propyl] fluoranthene-3,9-dicarboxylate?
bis[3-(diethylamino)propyl] fluoranthene-3,9-dicarboxylate has a molecular weight of 516.68 g/mol, XLogP of 6.26, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis[3-(diethylamino)propyl] fluoranthene-3,9-dicarboxylate is sourced from PubChem (CID 515653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).