About bis[3-(3-methylbutylamino)propyl] fluoranthene-3,9-dicarboxylate
bis[3-(3-methylbutylamino)propyl] fluoranthene-3,9-dicarboxylate (PubChem CID 515658) has the molecular formula C34H44N2O4
and a molecular weight of 544.74 g/mol. Its IUPAC name is bis[3-(3-methylbutylamino)propyl] fluoranthene-3,9-dicarboxylate.
Molecular Properties
| Compound Name | bis[3-(3-methylbutylamino)propyl] fluoranthene-3,9-dicarboxylate |
| PubChem CID | 515658 |
| Molecular Formula | C34H44N2O4 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | bis[3-(3-methylbutylamino)propyl] fluoranthene-3,9-dicarboxylate |
| SMILES | CC(C)CCNCCCOC(=O)c1ccc2c(c1)-c1ccc(C(=O)OCCCNCCC(C)C)c3cccc-2c13 |
| InChI | InChI=1S/C34H44N2O4/c1-23(2)14-18-35-16-6-20-39-33(37)25-10-11-26-27-8-5-9-28-30(13-12-29(32(27)28)31(26)22-25)34(38)40-21-7-17-36-19-15-24(3)4/h5,8-13,22-24,35-36H,6-7,14-21H2,1-4H3 |
| InChIKey | ATFRUZPFDCHEOJ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis[3-(3-methylbutylamino)propyl] fluoranthene-3,9-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[3-(3-methylbutylamino)propyl] fluoranthene-3,9-dicarboxylate?
The IUPAC name of bis[3-(3-methylbutylamino)propyl] fluoranthene-3,9-dicarboxylate (CID 515658) is bis[3-(3-methylbutylamino)propyl] fluoranthene-3,9-dicarboxylate.
What is the SMILES notation for bis[3-(3-methylbutylamino)propyl] fluoranthene-3,9-dicarboxylate?
The canonical SMILES for bis[3-(3-methylbutylamino)propyl] fluoranthene-3,9-dicarboxylate is CC(C)CCNCCCOC(=O)c1ccc2c(c1)-c1ccc(C(=O)OCCCNCCC(C)C)c3cccc-2c13.
What is the InChIKey of bis[3-(3-methylbutylamino)propyl] fluoranthene-3,9-dicarboxylate?
The InChIKey is ATFRUZPFDCHEOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H44N2O4/c1-23(2)14-18-35-16-6-20-39-33(37)25-10-11-26-27-8-5-9-28-30(13-12-29(32(27)28)31(26)22-25)34(38)40-21-7-17-36-19-15-24(3)4/h5,8-13,22-24,35-36H,6-7,14-21H2,1-4H3.
What are the key properties of bis[3-(3-methylbutylamino)propyl] fluoranthene-3,9-dicarboxylate?
bis[3-(3-methylbutylamino)propyl] fluoranthene-3,9-dicarboxylate has a molecular weight of 544.74 g/mol, XLogP of 6.85, 16 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis[3-(3-methylbutylamino)propyl] fluoranthene-3,9-dicarboxylate is sourced from PubChem (CID 515658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).