About 6-amino-1-benzyl-5-[2-(2,6-dimethylmorpholin-4-yl)acetyl]-3-methylpyrimidine-2,4-dione
6-amino-1-benzyl-5-[2-(2,6-dimethylmorpholin-4-yl)acetyl]-3-methylpyrimidine-2,4-dione (PubChem CID 5156725) has the molecular formula C20H26N4O4
and a molecular weight of 386.45 g/mol. Its IUPAC name is 6-amino-1-benzyl-5-[2-(2,6-dimethylmorpholin-4-yl)acetyl]-3-methylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-amino-1-benzyl-5-[2-(2,6-dimethylmorpholin-4-yl)acetyl]-3-methylpyrimidine-2,4-dione |
| PubChem CID | 5156725 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 6-amino-1-benzyl-5-[2-(2,6-dimethylmorpholin-4-yl)acetyl]-3-methylpyrimidine-2,4-dione |
| SMILES | CC1CN(CC(=O)c2c(N)n(Cc3ccccc3)c(=O)n(C)c2=O)CC(C)O1 |
| InChI | InChI=1S/C20H26N4O4/c1-13-9-23(10-14(2)28-13)12-16(25)17-18(21)24(20(27)22(3)19(17)26)11-15-7-5-4-6-8-15/h4-8,13-14H,9-12,21H2,1-3H3 |
| InChIKey | VQNYSBSTVTZCST-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 99.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 6-amino-1-benzyl-5-[2-(2,6-dimethylmorpholin-4-yl)acetyl]-3-methylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1-benzyl-5-[2-(2,6-dimethylmorpholin-4-yl)acetyl]-3-methylpyrimidine-2,4-dione?
The IUPAC name of 6-amino-1-benzyl-5-[2-(2,6-dimethylmorpholin-4-yl)acetyl]-3-methylpyrimidine-2,4-dione (CID 5156725) is 6-amino-1-benzyl-5-[2-(2,6-dimethylmorpholin-4-yl)acetyl]-3-methylpyrimidine-2,4-dione.
What is the SMILES notation for 6-amino-1-benzyl-5-[2-(2,6-dimethylmorpholin-4-yl)acetyl]-3-methylpyrimidine-2,4-dione?
The canonical SMILES for 6-amino-1-benzyl-5-[2-(2,6-dimethylmorpholin-4-yl)acetyl]-3-methylpyrimidine-2,4-dione is CC1CN(CC(=O)c2c(N)n(Cc3ccccc3)c(=O)n(C)c2=O)CC(C)O1.
What is the InChIKey of 6-amino-1-benzyl-5-[2-(2,6-dimethylmorpholin-4-yl)acetyl]-3-methylpyrimidine-2,4-dione?
The InChIKey is VQNYSBSTVTZCST-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N4O4/c1-13-9-23(10-14(2)28-13)12-16(25)17-18(21)24(20(27)22(3)19(17)26)11-15-7-5-4-6-8-15/h4-8,13-14H,9-12,21H2,1-3H3.
What are the key properties of 6-amino-1-benzyl-5-[2-(2,6-dimethylmorpholin-4-yl)acetyl]-3-methylpyrimidine-2,4-dione?
6-amino-1-benzyl-5-[2-(2,6-dimethylmorpholin-4-yl)acetyl]-3-methylpyrimidine-2,4-dione has a molecular weight of 386.45 g/mol, XLogP of 0.47, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1-benzyl-5-[2-(2,6-dimethylmorpholin-4-yl)acetyl]-3-methylpyrimidine-2,4-dione is sourced from PubChem (CID 5156725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).