C20H22N2O — CID 51567496
1-(2-methylprop-2-enyl)-2-[(1S)-1-phenoxypropyl]benzimidazole (PubChem CID 51567496) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-(2-methylprop-2-enyl)-2-[(1S)-1-phenoxypropyl]benzimidazole.
| Compound Name | 1-(2-methylprop-2-enyl)-2-[(1S)-1-phenoxypropyl]benzimidazole |
|---|---|
| PubChem CID | 51567496 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 1-(2-methylprop-2-enyl)-2-[(1S)-1-phenoxypropyl]benzimidazole |
| SMILES | C=C(C)Cn1c([C@H](CC)Oc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C20H22N2O/c1-4-19(23-16-10-6-5-7-11-16)20-21-17-12-8-9-13-18(17)22(20)14-15(2)3/h5-13,19H,2,4,14H2,1,3H3/t19-/m0/s1 |
| InChIKey | OPJWKGIHYIPTPW-IBGZPJMESA-N |
| XLogP | 5.14 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|