About 2-(2-hydroxyethyliminomethyl)-1,2-dihydroindol-3-one
2-(2-hydroxyethyliminomethyl)-1,2-dihydroindol-3-one (PubChem CID 51576390) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-(2-hydroxyethyliminomethyl)-1,2-dihydroindol-3-one.
Molecular Properties
| Compound Name | 2-(2-hydroxyethyliminomethyl)-1,2-dihydroindol-3-one |
| PubChem CID | 51576390 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-(2-hydroxyethyliminomethyl)-1,2-dihydroindol-3-one |
| SMILES | O=C1c2ccccc2NC1/C=N/CCO |
| InChI | InChI=1S/C11H12N2O2/c14-6-5-12-7-10-11(15)8-3-1-2-4-9(8)13-10/h1-4,7,10,13-14H,5-6H2/b12-7+ |
| InChIKey | KYRBIPFQNGQOQB-KPKJPENVSA-N |
| XLogP | 0.73 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethyliminomethyl)-1,2-dihydroindol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethyliminomethyl)-1,2-dihydroindol-3-one?
The IUPAC name of 2-(2-hydroxyethyliminomethyl)-1,2-dihydroindol-3-one (CID 51576390) is 2-(2-hydroxyethyliminomethyl)-1,2-dihydroindol-3-one.
What is the SMILES notation for 2-(2-hydroxyethyliminomethyl)-1,2-dihydroindol-3-one?
The canonical SMILES for 2-(2-hydroxyethyliminomethyl)-1,2-dihydroindol-3-one is O=C1c2ccccc2NC1/C=N/CCO.
What is the InChIKey of 2-(2-hydroxyethyliminomethyl)-1,2-dihydroindol-3-one?
The InChIKey is KYRBIPFQNGQOQB-KPKJPENVSA-N. The full InChI is InChI=1S/C11H12N2O2/c14-6-5-12-7-10-11(15)8-3-1-2-4-9(8)13-10/h1-4,7,10,13-14H,5-6H2/b12-7+.
What are the key properties of 2-(2-hydroxyethyliminomethyl)-1,2-dihydroindol-3-one?
2-(2-hydroxyethyliminomethyl)-1,2-dihydroindol-3-one has a molecular weight of 204.23 g/mol, XLogP of 0.73, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethyliminomethyl)-1,2-dihydroindol-3-one is sourced from PubChem (CID 51576390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).