C26H23FN2O6 — CID 51578292
(3S,3aR,6aS)-5-(4-fluorophenyl)-2-phenyl-3-(3,4,5-trimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 51578292) has the molecular formula C26H23FN2O6 and a molecular weight of 478.48 g/mol. Its IUPAC name is (3S,3aR,6aS)-5-(4-fluorophenyl)-2-phenyl-3-(3,4,5-trimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3S,3aR,6aS)-5-(4-fluorophenyl)-2-phenyl-3-(3,4,5-trimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 51578292 |
| Molecular Formula | C26H23FN2O6 |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | (3S,3aR,6aS)-5-(4-fluorophenyl)-2-phenyl-3-(3,4,5-trimethoxyphenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | COc1cc([C@@H]2[C@H]3C(=O)N(c4ccc(F)cc4)C(=O)[C@H]3ON2c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H23FN2O6/c1-32-19-13-15(14-20(33-2)23(19)34-3)22-21-24(35-29(22)18-7-5-4-6-8-18)26(31)28(25(21)30)17-11-9-16(27)10-12-17/h4-14,21-22,24H,1-3H3/t21-,22-,24+/m1/s1 |
| InChIKey | JWRCGTJYUIJFDO-AKFKNWHVSA-N |
| XLogP | 3.90 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|