C27H23ClN2O6 — CID 51579692
ethyl 4-[(3R,3aS,6aS)-2-(4-chlorophenyl)-3-(4-methoxyphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate (PubChem CID 51579692) has the molecular formula C27H23ClN2O6 and a molecular weight of 506.94 g/mol. Its IUPAC name is ethyl 4-[(3R,3aS,6aS)-2-(4-chlorophenyl)-3-(4-methoxyphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate.
| Compound Name | ethyl 4-[(3R,3aS,6aS)-2-(4-chlorophenyl)-3-(4-methoxyphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate |
|---|---|
| PubChem CID | 51579692 |
| Molecular Formula | C27H23ClN2O6 |
| Molecular Weight | 506.94 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | ethyl 4-[(3R,3aS,6aS)-2-(4-chlorophenyl)-3-(4-methoxyphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@@H]3[C@H](ON(c4ccc(Cl)cc4)[C@H]3c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C27H23ClN2O6/c1-3-35-27(33)17-4-10-19(11-5-17)29-25(31)22-23(16-6-14-21(34-2)15-7-16)30(36-24(22)26(29)32)20-12-8-18(28)9-13-20/h4-15,22-24H,3H2,1-2H3/t22-,23-,24-/m0/s1 |
| InChIKey | RWJVPNNPOYZWRN-HJOGWXRNSA-N |
| XLogP | 4.58 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.94 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|