C12H11NO2 — CID 5158225
spiro[1,2-dihydroindene-3,3'-pyrrolidine]-2',5'-dione (PubChem CID 5158225) has the molecular formula C12H11NO2 and a molecular weight of 201.23 g/mol. Its IUPAC name is spiro[1,2-dihydroindene-3,3'-pyrrolidine]-2',5'-dione.
| Compound Name | spiro[1,2-dihydroindene-3,3'-pyrrolidine]-2',5'-dione |
|---|---|
| PubChem CID | 5158225 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | spiro[1,2-dihydroindene-3,3'-pyrrolidine]-2',5'-dione |
| SMILES | O=C1CC2(CCc3ccccc32)C(=O)N1 |
| InChI | InChI=1S/C12H11NO2/c14-10-7-12(11(15)13-10)6-5-8-3-1-2-4-9(8)12/h1-4H,5-7H2,(H,13,14,15) |
| InChIKey | GOCQZJLHIGURBI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|