C15H15FN2O2 — CID 51583258
(2S)-1-(2-fluorobenzoyl)-N-prop-2-enyl-2,5-dihydropyrrole-2-carboxamide (PubChem CID 51583258) has the molecular formula C15H15FN2O2 and a molecular weight of 274.30 g/mol. Its IUPAC name is (2S)-1-(2-fluorobenzoyl)-N-prop-2-enyl-2,5-dihydropyrrole-2-carboxamide.
| Compound Name | (2S)-1-(2-fluorobenzoyl)-N-prop-2-enyl-2,5-dihydropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 51583258 |
| Molecular Formula | C15H15FN2O2 |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (2S)-1-(2-fluorobenzoyl)-N-prop-2-enyl-2,5-dihydropyrrole-2-carboxamide |
| SMILES | C=CCNC(=O)[C@@H]1C=CCN1C(=O)c1ccccc1F |
| InChI | InChI=1S/C15H15FN2O2/c1-2-9-17-14(19)13-8-5-10-18(13)15(20)11-6-3-4-7-12(11)16/h2-8,13H,1,9-10H2,(H,17,19)/t13-/m0/s1 |
| InChIKey | NIVNCMWYPVTIKV-ZDUSSCGKSA-N |
| XLogP | 1.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|