C20H17N3O2S — CID 5158339
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(3-formylindol-1-yl)acetamide (PubChem CID 5158339) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(3-formylindol-1-yl)acetamide.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(3-formylindol-1-yl)acetamide |
|---|---|
| PubChem CID | 5158339 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-(3-formylindol-1-yl)acetamide |
| SMILES | N#Cc1c(NC(=O)Cn2cc(C=O)c3ccccc32)sc2c1CCCC2 |
| InChI | InChI=1S/C20H17N3O2S/c21-9-16-15-6-2-4-8-18(15)26-20(16)22-19(25)11-23-10-13(12-24)14-5-1-3-7-17(14)23/h1,3,5,7,10,12H,2,4,6,8,11H2,(H,22,25) |
| InChIKey | BBVDQYMBFSAOGH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 74.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|