C17H21FN2O — CID 51584502
5-[(2S)-1-[(2-fluorophenyl)methyl]azepan-2-yl]-3-methyl-1,2-oxazole (PubChem CID 51584502) has the molecular formula C17H21FN2O and a molecular weight of 288.37 g/mol. Its IUPAC name is 5-[(2S)-1-[(2-fluorophenyl)methyl]azepan-2-yl]-3-methyl-1,2-oxazole.
| Compound Name | 5-[(2S)-1-[(2-fluorophenyl)methyl]azepan-2-yl]-3-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 51584502 |
| Molecular Formula | C17H21FN2O |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 5-[(2S)-1-[(2-fluorophenyl)methyl]azepan-2-yl]-3-methyl-1,2-oxazole |
| SMILES | Cc1cc([C@@H]2CCCCCN2Cc2ccccc2F)on1 |
| InChI | InChI=1S/C17H21FN2O/c1-13-11-17(21-19-13)16-9-3-2-6-10-20(16)12-14-7-4-5-8-15(14)18/h4-5,7-8,11,16H,2-3,6,9-10,12H2,1H3/t16-/m0/s1 |
| InChIKey | HMGKRVZJTZNNHZ-INIZCTEOSA-N |
| XLogP | 4.24 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |