C24H20BrN3O2 — CID 51585489
(2S,6S,7R)-7-(4-bromophenyl)-4-naphthalen-1-yl-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione (PubChem CID 51585489) has the molecular formula C24H20BrN3O2 and a molecular weight of 462.35 g/mol. Its IUPAC name is (2S,6S,7R)-7-(4-bromophenyl)-4-naphthalen-1-yl-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione.
| Compound Name | (2S,6S,7R)-7-(4-bromophenyl)-4-naphthalen-1-yl-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione |
|---|---|
| PubChem CID | 51585489 |
| Molecular Formula | C24H20BrN3O2 |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | (2S,6S,7R)-7-(4-bromophenyl)-4-naphthalen-1-yl-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1c1cccc3ccccc13)N1CCCN1[C@H]2c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H20BrN3O2/c25-17-11-9-16(10-12-17)21-20-22(27-14-4-13-26(21)27)24(30)28(23(20)29)19-8-3-6-15-5-1-2-7-18(15)19/h1-3,5-12,20-22H,4,13-14H2/t20-,21-,22-/m0/s1 |
| InChIKey | FUKKCRWUMDKAFP-FKBYEOEOSA-N |
| XLogP | 4.14 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|