C20H16Cl2N4O4 — CID 51585497
(2S,6R,7R)-4-(4-chloro-3-nitrophenyl)-7-(4-chlorophenyl)-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione (PubChem CID 51585497) has the molecular formula C20H16Cl2N4O4 and a molecular weight of 447.28 g/mol. Its IUPAC name is (2S,6R,7R)-4-(4-chloro-3-nitrophenyl)-7-(4-chlorophenyl)-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione.
| Compound Name | (2S,6R,7R)-4-(4-chloro-3-nitrophenyl)-7-(4-chlorophenyl)-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione |
|---|---|
| PubChem CID | 51585497 |
| Molecular Formula | C20H16Cl2N4O4 |
| Molecular Weight | 447.28 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | (2S,6R,7R)-4-(4-chloro-3-nitrophenyl)-7-(4-chlorophenyl)-1,4,8-triazatricyclo[6.3.0.02,6]undecane-3,5-dione |
| SMILES | O=C1[C@H]2[C@@H](C(=O)N1c1ccc(Cl)c([N+](=O)[O-])c1)N1CCCN1[C@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H16Cl2N4O4/c21-12-4-2-11(3-5-12)17-16-18(24-9-1-8-23(17)24)20(28)25(19(16)27)13-6-7-14(22)15(10-13)26(29)30/h2-7,10,16-18H,1,8-9H2/t16-,17+,18+/m1/s1 |
| InChIKey | GOHDMJMWXUVVEM-SQNIBIBYSA-N |
| XLogP | 3.44 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|