C19H23N3O4 — CID 51586216
2-[(2S)-6-methyl-2',4-dioxospiro[3H-1,3-benzoxazine-2,5'-azepane]-1'-yl]-N-prop-2-enylacetamide (PubChem CID 51586216) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-[(2S)-6-methyl-2',4-dioxospiro[3H-1,3-benzoxazine-2,5'-azepane]-1'-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[(2S)-6-methyl-2',4-dioxospiro[3H-1,3-benzoxazine-2,5'-azepane]-1'-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 51586216 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-[(2S)-6-methyl-2',4-dioxospiro[3H-1,3-benzoxazine-2,5'-azepane]-1'-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN1CC[C@@]2(CCC1=O)NC(=O)c1cc(C)ccc1O2 |
| InChI | InChI=1S/C19H23N3O4/c1-3-9-20-16(23)12-22-10-8-19(7-6-17(22)24)21-18(25)14-11-13(2)4-5-15(14)26-19/h3-5,11H,1,6-10,12H2,2H3,(H,20,23)(H,21,25)/t19-/m0/s1 |
| InChIKey | RCVIMDXXZUNCAH-IBGZPJMESA-N |
| XLogP | 1.13 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|