C36H42N2O4S — CID 5158728
ethyl 2-[[2-(4-propoxyphenyl)quinoline-4-carbonyl]amino]-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophene-3-carboxylate (PubChem CID 5158728) has the molecular formula C36H42N2O4S and a molecular weight of 598.81 g/mol. Its IUPAC name is ethyl 2-[[2-(4-propoxyphenyl)quinoline-4-carbonyl]amino]-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(4-propoxyphenyl)quinoline-4-carbonyl]amino]-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 5158728 |
| Molecular Formula | C36H42N2O4S |
| Molecular Weight | 598.81 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | ethyl 2-[[2-(4-propoxyphenyl)quinoline-4-carbonyl]amino]-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]thiophene-3-carboxylate |
| SMILES | CCCOc1ccc(-c2cc(C(=O)Nc3sc4c(c3C(=O)OCC)CCCCCCCCCC4)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C36H42N2O4S/c1-3-23-42-26-21-19-25(20-22-26)31-24-29(27-15-13-14-17-30(27)37-31)34(39)38-35-33(36(40)41-4-2)28-16-11-9-7-5-6-8-10-12-18-32(28)43-35/h13-15,17,19-22,24H,3-12,16,18,23H2,1-2H3,(H,38,39) |
| InChIKey | MSVLYEBYEGWXGN-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.81 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |