About N-[2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzamide
N-[2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzamide (PubChem CID 5158821) has the molecular formula C20H20N2O2
and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzamide.
Molecular Properties
| Compound Name | N-[2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzamide |
| PubChem CID | 5158821 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-[2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzamide |
| SMILES | CN1C(=CC(=O)NC(=O)c2ccccc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C20H20N2O2/c1-20(2)15-11-7-8-12-16(15)22(3)17(20)13-18(23)21-19(24)14-9-5-4-6-10-14/h4-13H,1-3H3,(H,21,23,24) |
| InChIKey | ZWTOLCFYYTUEEH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzamide?
The IUPAC name of N-[2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzamide (CID 5158821) is N-[2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzamide.
What is the SMILES notation for N-[2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzamide?
The canonical SMILES for N-[2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzamide is CN1C(=CC(=O)NC(=O)c2ccccc2)C(C)(C)c2ccccc21.
What is the InChIKey of N-[2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzamide?
The InChIKey is ZWTOLCFYYTUEEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O2/c1-20(2)15-11-7-8-12-16(15)22(3)17(20)13-18(23)21-19(24)14-9-5-4-6-10-14/h4-13H,1-3H3,(H,21,23,24).
What are the key properties of N-[2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzamide?
N-[2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzamide has a molecular weight of 320.39 g/mol, XLogP of 3.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzamide is sourced from PubChem (CID 5158821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).