C42H41N7O3 — CID 515885
(4R,5S,6S,7R)-1-[[3-(1H-benzimidazol-2-ylmethylamino)phenyl]methyl]-4,7-dibenzyl-5,6-dihydroxy-3-(1H-indazol-5-ylmethyl)-1,3-diazepan-2-one (PubChem CID 515885) has the molecular formula C42H41N7O3 and a molecular weight of 691.84 g/mol. Its IUPAC name is (4R,5S,6S,7R)-1-[[3-(1H-benzimidazol-2-ylmethylamino)phenyl]methyl]-4,7-dibenzyl-5,6-dihydroxy-3-(1H-indazol-5-ylmethyl)-1,3-diazepan-2-one.
| Compound Name | (4R,5S,6S,7R)-1-[[3-(1H-benzimidazol-2-ylmethylamino)phenyl]methyl]-4,7-dibenzyl-5,6-dihydroxy-3-(1H-indazol-5-ylmethyl)-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 515885 |
| Molecular Formula | C42H41N7O3 |
| Molecular Weight | 691.84 g/mol |
| Exact Mass | 691.33 |
| IUPAC Name | (4R,5S,6S,7R)-1-[[3-(1H-benzimidazol-2-ylmethylamino)phenyl]methyl]-4,7-dibenzyl-5,6-dihydroxy-3-(1H-indazol-5-ylmethyl)-1,3-diazepan-2-one |
| SMILES | O=C1N(Cc2cccc(NCc3nc4ccccc4[nH]3)c2)[C@H](Cc2ccccc2)[C@H](O)[C@@H](O)[C@@H](Cc2ccccc2)N1Cc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C42H41N7O3/c50-40-37(22-28-10-3-1-4-11-28)48(26-30-14-9-15-33(21-30)43-25-39-45-35-16-7-8-17-36(35)46-39)42(52)49(27-31-18-19-34-32(20-31)24-44-47-34)38(41(40)51)23-29-12-5-2-6-13-29/h1-21,24,37-38,40-41,43,50-51H,22-23,25-27H2,(H,44,47)(H,45,46)/t37-,38-,40+,41+/m1/s1 |
| InChIKey | ZZEQQJBEFIZMSK-ZAGYQXHLSA-N |
| XLogP | 6.43 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.84 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |