C42H40FN7O3 — CID 515886
(4R,5S,6S,7R)-1-[[3-(1H-benzimidazol-2-ylmethylamino)-4-fluorophenyl]methyl]-4,7-dibenzyl-5,6-dihydroxy-3-(1H-indazol-5-ylmethyl)-1,3-diazepan-2-one (PubChem CID 515886) has the molecular formula C42H40FN7O3 and a molecular weight of 709.83 g/mol. Its IUPAC name is (4R,5S,6S,7R)-1-[[3-(1H-benzimidazol-2-ylmethylamino)-4-fluorophenyl]methyl]-4,7-dibenzyl-5,6-dihydroxy-3-(1H-indazol-5-ylmethyl)-1,3-diazepan-2-one.
| Compound Name | (4R,5S,6S,7R)-1-[[3-(1H-benzimidazol-2-ylmethylamino)-4-fluorophenyl]methyl]-4,7-dibenzyl-5,6-dihydroxy-3-(1H-indazol-5-ylmethyl)-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 515886 |
| Molecular Formula | C42H40FN7O3 |
| Molecular Weight | 709.83 g/mol |
| Exact Mass | 709.32 |
| IUPAC Name | (4R,5S,6S,7R)-1-[[3-(1H-benzimidazol-2-ylmethylamino)-4-fluorophenyl]methyl]-4,7-dibenzyl-5,6-dihydroxy-3-(1H-indazol-5-ylmethyl)-1,3-diazepan-2-one |
| SMILES | O=C1N(Cc2ccc(F)c(NCc3nc4ccccc4[nH]3)c2)[C@H](Cc2ccccc2)[C@H](O)[C@@H](O)[C@@H](Cc2ccccc2)N1Cc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C42H40FN7O3/c43-32-17-15-30(20-36(32)44-24-39-46-34-13-7-8-14-35(34)47-39)26-50-38(22-28-11-5-2-6-12-28)41(52)40(51)37(21-27-9-3-1-4-10-27)49(42(50)53)25-29-16-18-33-31(19-29)23-45-48-33/h1-20,23,37-38,40-41,44,51-52H,21-22,24-26H2,(H,45,48)(H,46,47)/t37-,38-,40+,41+/m1/s1 |
| InChIKey | PVRCWMUDFFKIAS-ZAGYQXHLSA-N |
| XLogP | 6.57 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.83 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |