About methyl 2-acetamido-4,5-dimethylthiophene-3-carboxylate
methyl 2-acetamido-4,5-dimethylthiophene-3-carboxylate (PubChem CID 5158903) has the molecular formula C10H13NO3S
and a molecular weight of 227.28 g/mol. Its IUPAC name is methyl 2-acetamido-4,5-dimethylthiophene-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-acetamido-4,5-dimethylthiophene-3-carboxylate |
| PubChem CID | 5158903 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | methyl 2-acetamido-4,5-dimethylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(C)=O)sc(C)c1C |
| InChI | InChI=1S/C10H13NO3S/c1-5-6(2)15-9(11-7(3)12)8(5)10(13)14-4/h1-4H3,(H,11,12) |
| InChIKey | JJNXBVUWSDNXSK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-acetamido-4,5-dimethylthiophene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-acetamido-4,5-dimethylthiophene-3-carboxylate?
The IUPAC name of methyl 2-acetamido-4,5-dimethylthiophene-3-carboxylate (CID 5158903) is methyl 2-acetamido-4,5-dimethylthiophene-3-carboxylate.
What is the SMILES notation for methyl 2-acetamido-4,5-dimethylthiophene-3-carboxylate?
The canonical SMILES for methyl 2-acetamido-4,5-dimethylthiophene-3-carboxylate is COC(=O)c1c(NC(C)=O)sc(C)c1C.
What is the InChIKey of methyl 2-acetamido-4,5-dimethylthiophene-3-carboxylate?
The InChIKey is JJNXBVUWSDNXSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3S/c1-5-6(2)15-9(11-7(3)12)8(5)10(13)14-4/h1-4H3,(H,11,12).
What are the key properties of methyl 2-acetamido-4,5-dimethylthiophene-3-carboxylate?
methyl 2-acetamido-4,5-dimethylthiophene-3-carboxylate has a molecular weight of 227.28 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetamido-4,5-dimethylthiophene-3-carboxylate is sourced from PubChem (CID 5158903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).