C20H33N5 — CID 51590087
4-[[(2R)-2-(piperidin-1-ylmethyl)piperidin-1-yl]methyl]-2-pyrrolidin-1-ylpyrimidine (PubChem CID 51590087) has the molecular formula C20H33N5 and a molecular weight of 343.52 g/mol. Its IUPAC name is 4-[[(2R)-2-(piperidin-1-ylmethyl)piperidin-1-yl]methyl]-2-pyrrolidin-1-ylpyrimidine.
| Compound Name | 4-[[(2R)-2-(piperidin-1-ylmethyl)piperidin-1-yl]methyl]-2-pyrrolidin-1-ylpyrimidine |
|---|---|
| PubChem CID | 51590087 |
| Molecular Formula | C20H33N5 |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | 4-[[(2R)-2-(piperidin-1-ylmethyl)piperidin-1-yl]methyl]-2-pyrrolidin-1-ylpyrimidine |
| SMILES | c1cc(CN2CCCC[C@@H]2CN2CCCCC2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C20H33N5/c1-3-11-23(12-4-1)17-19-8-2-5-15-25(19)16-18-9-10-21-20(22-18)24-13-6-7-14-24/h9-10,19H,1-8,11-17H2/t19-/m1/s1 |
| InChIKey | QAWKLLYESJUVRX-LJQANCHMSA-N |
| XLogP | 2.92 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |