About 1-methyl-5-nitroindole-2,3-dione
1-methyl-5-nitroindole-2,3-dione (PubChem CID 515950) has the molecular formula C9H6N2O4
and a molecular weight of 206.16 g/mol. Its IUPAC name is 1-methyl-5-nitroindole-2,3-dione.
Molecular Properties
| Compound Name | 1-methyl-5-nitroindole-2,3-dione |
| PubChem CID | 515950 |
| Molecular Formula | C9H6N2O4 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 1-methyl-5-nitroindole-2,3-dione |
| SMILES | CN1C(=O)C(=O)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C9H6N2O4/c1-10-7-3-2-5(11(14)15)4-6(7)8(12)9(10)13/h2-4H,1H3 |
| InChIKey | JPTDPTOWOMFBRY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-5-nitroindole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-nitroindole-2,3-dione?
The IUPAC name of 1-methyl-5-nitroindole-2,3-dione (CID 515950) is 1-methyl-5-nitroindole-2,3-dione.
What is the SMILES notation for 1-methyl-5-nitroindole-2,3-dione?
The canonical SMILES for 1-methyl-5-nitroindole-2,3-dione is CN1C(=O)C(=O)c2cc([N+](=O)[O-])ccc21.
What is the InChIKey of 1-methyl-5-nitroindole-2,3-dione?
The InChIKey is JPTDPTOWOMFBRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O4/c1-10-7-3-2-5(11(14)15)4-6(7)8(12)9(10)13/h2-4H,1H3.
What are the key properties of 1-methyl-5-nitroindole-2,3-dione?
1-methyl-5-nitroindole-2,3-dione has a molecular weight of 206.16 g/mol, XLogP of 0.75, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-nitroindole-2,3-dione is sourced from PubChem (CID 515950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).