C22H25N3O4 — CID 51595808
[(3aS,7aS)-2-pyridin-3-yl-3a,4,5,6,7,7a-hexahydrobenzimidazol-1-yl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 51595808) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is [(3aS,7aS)-2-pyridin-3-yl-3a,4,5,6,7,7a-hexahydrobenzimidazol-1-yl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [(3aS,7aS)-2-pyridin-3-yl-3a,4,5,6,7,7a-hexahydrobenzimidazol-1-yl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 51595808 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | [(3aS,7aS)-2-pyridin-3-yl-3a,4,5,6,7,7a-hexahydrobenzimidazol-1-yl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)N2C(c3cccnc3)=N[C@H]3CCCC[C@@H]32)cc(OC)c1OC |
| InChI | InChI=1S/C22H25N3O4/c1-27-18-11-15(12-19(28-2)20(18)29-3)22(26)25-17-9-5-4-8-16(17)24-21(25)14-7-6-10-23-13-14/h6-7,10-13,16-17H,4-5,8-9H2,1-3H3/t16-,17-/m0/s1 |
| InChIKey | MFQXATZOALXCAD-IRXDYDNUSA-N |
| XLogP | 3.32 |
| TPSA | 73.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |