C19H25N5O4S — CID 51596067
(1,5-dimethylpyrazol-4-yl)-[4-[(3S)-6-methoxy-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl]piperidin-1-yl]methanone (PubChem CID 51596067) has the molecular formula C19H25N5O4S and a molecular weight of 419.51 g/mol. Its IUPAC name is (1,5-dimethylpyrazol-4-yl)-[4-[(3S)-6-methoxy-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl]piperidin-1-yl]methanone.
| Compound Name | (1,5-dimethylpyrazol-4-yl)-[4-[(3S)-6-methoxy-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 51596067 |
| Molecular Formula | C19H25N5O4S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | (1,5-dimethylpyrazol-4-yl)-[4-[(3S)-6-methoxy-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl]piperidin-1-yl]methanone |
| SMILES | COc1ccc2c(c1)N[C@H](C1CCN(C(=O)c3cnn(C)c3C)CC1)NS2(=O)=O |
| InChI | InChI=1S/C19H25N5O4S/c1-12-15(11-20-23(12)2)19(25)24-8-6-13(7-9-24)18-21-16-10-14(28-3)4-5-17(16)29(26,27)22-18/h4-5,10-11,13,18,21-22H,6-9H2,1-3H3/t18-/m0/s1 |
| InChIKey | VOFCPSOKZMORLU-SFHVURJKSA-N |
| XLogP | 1.32 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |