About 1-(difluoromethyl)-3,5-dimethyl-N-[(2S)-2-pyrrolidin-1-ylpropyl]pyrazole-4-sulfonamide
1-(difluoromethyl)-3,5-dimethyl-N-[(2S)-2-pyrrolidin-1-ylpropyl]pyrazole-4-sulfonamide (PubChem CID 51597910) has the molecular formula C13H22F2N4O2S
and a molecular weight of 336.41 g/mol. Its IUPAC name is 1-(difluoromethyl)-3,5-dimethyl-N-[(2S)-2-pyrrolidin-1-ylpropyl]pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1-(difluoromethyl)-3,5-dimethyl-N-[(2S)-2-pyrrolidin-1-ylpropyl]pyrazole-4-sulfonamide |
| PubChem CID | 51597910 |
| Molecular Formula | C13H22F2N4O2S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 1-(difluoromethyl)-3,5-dimethyl-N-[(2S)-2-pyrrolidin-1-ylpropyl]pyrazole-4-sulfonamide |
| SMILES | Cc1nn(C(F)F)c(C)c1S(=O)(=O)NC[C@H](C)N1CCCC1 |
| InChI | InChI=1S/C13H22F2N4O2S/c1-9(18-6-4-5-7-18)8-16-22(20,21)12-10(2)17-19(11(12)3)13(14)15/h9,13,16H,4-8H2,1-3H3/t9-/m0/s1 |
| InChIKey | ZXPQXXBFZWPCFA-VIFPVBQESA-N |
| XLogP | 1.66 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(difluoromethyl)-3,5-dimethyl-N-[(2S)-2-pyrrolidin-1-ylpropyl]pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(difluoromethyl)-3,5-dimethyl-N-[(2S)-2-pyrrolidin-1-ylpropyl]pyrazole-4-sulfonamide?
The IUPAC name of 1-(difluoromethyl)-3,5-dimethyl-N-[(2S)-2-pyrrolidin-1-ylpropyl]pyrazole-4-sulfonamide (CID 51597910) is 1-(difluoromethyl)-3,5-dimethyl-N-[(2S)-2-pyrrolidin-1-ylpropyl]pyrazole-4-sulfonamide.
What is the SMILES notation for 1-(difluoromethyl)-3,5-dimethyl-N-[(2S)-2-pyrrolidin-1-ylpropyl]pyrazole-4-sulfonamide?
The canonical SMILES for 1-(difluoromethyl)-3,5-dimethyl-N-[(2S)-2-pyrrolidin-1-ylpropyl]pyrazole-4-sulfonamide is Cc1nn(C(F)F)c(C)c1S(=O)(=O)NC[C@H](C)N1CCCC1.
What is the InChIKey of 1-(difluoromethyl)-3,5-dimethyl-N-[(2S)-2-pyrrolidin-1-ylpropyl]pyrazole-4-sulfonamide?
The InChIKey is ZXPQXXBFZWPCFA-VIFPVBQESA-N. The full InChI is InChI=1S/C13H22F2N4O2S/c1-9(18-6-4-5-7-18)8-16-22(20,21)12-10(2)17-19(11(12)3)13(14)15/h9,13,16H,4-8H2,1-3H3/t9-/m0/s1.
What are the key properties of 1-(difluoromethyl)-3,5-dimethyl-N-[(2S)-2-pyrrolidin-1-ylpropyl]pyrazole-4-sulfonamide?
1-(difluoromethyl)-3,5-dimethyl-N-[(2S)-2-pyrrolidin-1-ylpropyl]pyrazole-4-sulfonamide has a molecular weight of 336.41 g/mol, XLogP of 1.66, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(difluoromethyl)-3,5-dimethyl-N-[(2S)-2-pyrrolidin-1-ylpropyl]pyrazole-4-sulfonamide is sourced from PubChem (CID 51597910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).