C23H28N2O2 — CID 515988
4-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]-N,N-dimethylaniline (PubChem CID 515988) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]-N,N-dimethylaniline.
| Compound Name | 4-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 515988 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 4-[3,5-dimethyl-4-[3-(3-methyl-1,2-oxazol-5-yl)propoxy]phenyl]-N,N-dimethylaniline |
| SMILES | Cc1cc(CCCOc2c(C)cc(-c3ccc(N(C)C)cc3)cc2C)on1 |
| InChI | InChI=1S/C23H28N2O2/c1-16-13-20(19-8-10-21(11-9-19)25(4)5)14-17(2)23(16)26-12-6-7-22-15-18(3)24-27-22/h8-11,13-15H,6-7,12H2,1-5H3 |
| InChIKey | USAFZFPFFJBHGT-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|