C21H26N4O5 — CID 51599027
3-[(4S)-1-cyclohexyl-2,5-dioxoimidazolidin-4-yl]-N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)propanamide (PubChem CID 51599027) has the molecular formula C21H26N4O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is 3-[(4S)-1-cyclohexyl-2,5-dioxoimidazolidin-4-yl]-N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)propanamide.
| Compound Name | 3-[(4S)-1-cyclohexyl-2,5-dioxoimidazolidin-4-yl]-N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)propanamide |
|---|---|
| PubChem CID | 51599027 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 3-[(4S)-1-cyclohexyl-2,5-dioxoimidazolidin-4-yl]-N-(4-methyl-3-oxo-1,4-benzoxazin-6-yl)propanamide |
| SMILES | CN1C(=O)COc2ccc(NC(=O)CC[C@@H]3NC(=O)N(C4CCCCC4)C3=O)cc21 |
| InChI | InChI=1S/C21H26N4O5/c1-24-16-11-13(7-9-17(16)30-12-19(24)27)22-18(26)10-8-15-20(28)25(21(29)23-15)14-5-3-2-4-6-14/h7,9,11,14-15H,2-6,8,10,12H2,1H3,(H,22,26)(H,23,29)/t15-/m0/s1 |
| InChIKey | AJIUZGBSDLSLMR-HNNXBMFYSA-N |
| XLogP | 2.01 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|