C18H26N4 — CID 51599989
N-methyl-N-[(5-methyl-1H-pyrazol-3-yl)methyl]-1-(2-piperidin-1-ylphenyl)methanamine (PubChem CID 51599989) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is N-methyl-N-[(5-methyl-1H-pyrazol-3-yl)methyl]-1-(2-piperidin-1-ylphenyl)methanamine.
| Compound Name | N-methyl-N-[(5-methyl-1H-pyrazol-3-yl)methyl]-1-(2-piperidin-1-ylphenyl)methanamine |
|---|---|
| PubChem CID | 51599989 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | N-methyl-N-[(5-methyl-1H-pyrazol-3-yl)methyl]-1-(2-piperidin-1-ylphenyl)methanamine |
| SMILES | Cc1cc(CN(C)Cc2ccccc2N2CCCCC2)n[nH]1 |
| InChI | InChI=1S/C18H26N4/c1-15-12-17(20-19-15)14-21(2)13-16-8-4-5-9-18(16)22-10-6-3-7-11-22/h4-5,8-9,12H,3,6-7,10-11,13-14H2,1-2H3,(H,19,20) |
| InChIKey | NNQLXVDDLFBZGL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |