About (3S)-5-bromo-1-(2-methylpropyl)-2,3-dihydroindol-3-amine
(3S)-5-bromo-1-(2-methylpropyl)-2,3-dihydroindol-3-amine (PubChem CID 51601161) has the molecular formula C12H17BrN2
and a molecular weight of 269.19 g/mol. Its IUPAC name is (3S)-5-bromo-1-(2-methylpropyl)-2,3-dihydroindol-3-amine.
Molecular Properties
| Compound Name | (3S)-5-bromo-1-(2-methylpropyl)-2,3-dihydroindol-3-amine |
| PubChem CID | 51601161 |
| Molecular Formula | C12H17BrN2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | (3S)-5-bromo-1-(2-methylpropyl)-2,3-dihydroindol-3-amine |
| SMILES | CC(C)CN1C[C@@H](N)c2cc(Br)ccc21 |
| InChI | InChI=1S/C12H17BrN2/c1-8(2)6-15-7-11(14)10-5-9(13)3-4-12(10)15/h3-5,8,11H,6-7,14H2,1-2H3/t11-/m1/s1 |
| InChIKey | PXQFLQPZJOJERB-LLVKDONJSA-N |
| XLogP | 2.92 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-5-bromo-1-(2-methylpropyl)-2,3-dihydroindol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-5-bromo-1-(2-methylpropyl)-2,3-dihydroindol-3-amine?
The IUPAC name of (3S)-5-bromo-1-(2-methylpropyl)-2,3-dihydroindol-3-amine (CID 51601161) is (3S)-5-bromo-1-(2-methylpropyl)-2,3-dihydroindol-3-amine.
What is the SMILES notation for (3S)-5-bromo-1-(2-methylpropyl)-2,3-dihydroindol-3-amine?
The canonical SMILES for (3S)-5-bromo-1-(2-methylpropyl)-2,3-dihydroindol-3-amine is CC(C)CN1C[C@@H](N)c2cc(Br)ccc21.
What is the InChIKey of (3S)-5-bromo-1-(2-methylpropyl)-2,3-dihydroindol-3-amine?
The InChIKey is PXQFLQPZJOJERB-LLVKDONJSA-N. The full InChI is InChI=1S/C12H17BrN2/c1-8(2)6-15-7-11(14)10-5-9(13)3-4-12(10)15/h3-5,8,11H,6-7,14H2,1-2H3/t11-/m1/s1.
What are the key properties of (3S)-5-bromo-1-(2-methylpropyl)-2,3-dihydroindol-3-amine?
(3S)-5-bromo-1-(2-methylpropyl)-2,3-dihydroindol-3-amine has a molecular weight of 269.19 g/mol, XLogP of 2.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-5-bromo-1-(2-methylpropyl)-2,3-dihydroindol-3-amine is sourced from PubChem (CID 51601161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).