C9H7FO — CID 51601335
(1aR,6aS)-5-fluoro-6,6a-dihydro-1aH-indeno[1,2-b]oxirene (PubChem CID 51601335) has the molecular formula C9H7FO and a molecular weight of 150.15 g/mol. Its IUPAC name is (1aR,6aS)-5-fluoro-6,6a-dihydro-1aH-indeno[1,2-b]oxirene.
| Compound Name | (1aR,6aS)-5-fluoro-6,6a-dihydro-1aH-indeno[1,2-b]oxirene |
|---|---|
| PubChem CID | 51601335 |
| Molecular Formula | C9H7FO |
| Molecular Weight | 150.15 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | (1aR,6aS)-5-fluoro-6,6a-dihydro-1aH-indeno[1,2-b]oxirene |
| SMILES | Fc1cccc2c1C[C@@H]1O[C@H]21 |
| InChI | InChI=1S/C9H7FO/c10-7-3-1-2-5-6(7)4-8-9(5)11-8/h1-3,8-9H,4H2/t8-,9+/m0/s1 |
| InChIKey | RULQWECAZVIBNL-DTWKUNHWSA-N |
| XLogP | 1.82 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.15 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|