C26H32N4O5S2 — CID 5160901
N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-(6-morpholin-4-ylsulfonyl-3-oxo-1,4-benzothiazin-4-yl)acetamide (PubChem CID 5160901) has the molecular formula C26H32N4O5S2 and a molecular weight of 544.70 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-(6-morpholin-4-ylsulfonyl-3-oxo-1,4-benzothiazin-4-yl)acetamide.
| Compound Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-(6-morpholin-4-ylsulfonyl-3-oxo-1,4-benzothiazin-4-yl)acetamide |
|---|---|
| PubChem CID | 5160901 |
| Molecular Formula | C26H32N4O5S2 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-(6-morpholin-4-ylsulfonyl-3-oxo-1,4-benzothiazin-4-yl)acetamide |
| SMILES | O=C(CN1C(=O)CSc2ccc(S(=O)(=O)N3CCOCC3)cc21)NCCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C26H32N4O5S2/c31-25(27-9-3-10-28-11-8-20-4-1-2-5-21(20)17-28)18-30-23-16-22(6-7-24(23)36-19-26(30)32)37(33,34)29-12-14-35-15-13-29/h1-2,4-7,16H,3,8-15,17-19H2,(H,27,31) |
| InChIKey | ROXNAMIAPYSKCC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|