C24H31N3O4 — CID 5161014
ethyl 4-[[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-prop-2-enylamino]-4-oxobutanoate (PubChem CID 5161014) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is ethyl 4-[[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-prop-2-enylamino]-4-oxobutanoate.
| Compound Name | ethyl 4-[[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-prop-2-enylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 5161014 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | ethyl 4-[[2-[benzyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-prop-2-enylamino]-4-oxobutanoate |
| SMILES | C=CCN(CC(=O)N(Cc1ccccc1)Cc1cccn1C)C(=O)CCC(=O)OCC |
| InChI | InChI=1S/C24H31N3O4/c1-4-15-26(22(28)13-14-24(30)31-5-2)19-23(29)27(17-20-10-7-6-8-11-20)18-21-12-9-16-25(21)3/h4,6-12,16H,1,5,13-15,17-19H2,2-3H3 |
| InChIKey | FZSYVHBMZLNYBW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|