About (2-oxo-1,2-diphenylethyl) 4-[(2,6-dimethoxy-3-pyridinyl)-methylsulfonylamino]-4-oxobutanoate
(2-oxo-1,2-diphenylethyl) 4-[(2,6-dimethoxy-3-pyridinyl)-methylsulfonylamino]-4-oxobutanoate (PubChem CID 5161036) has the molecular formula C26H26N2O8S
and a molecular weight of 526.57 g/mol. Its IUPAC name is (2-oxo-1,2-diphenylethyl) 4-[(2,6-dimethoxy-3-pyridinyl)-methylsulfonylamino]-4-oxobutanoate.
Molecular Properties
| Compound Name | (2-oxo-1,2-diphenylethyl) 4-[(2,6-dimethoxy-3-pyridinyl)-methylsulfonylamino]-4-oxobutanoate |
| PubChem CID | 5161036 |
| Molecular Formula | C26H26N2O8S |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | (2-oxo-1,2-diphenylethyl) 4-[(2,6-dimethoxy-3-pyridinyl)-methylsulfonylamino]-4-oxobutanoate |
| SMILES | COc1ccc(N(C(=O)CCC(=O)OC(C(=O)c2ccccc2)c2ccccc2)S(C)(=O)=O)c(OC)n1 |
| InChI | InChI=1S/C26H26N2O8S/c1-34-21-15-14-20(26(27-21)35-2)28(37(3,32)33)22(29)16-17-23(30)36-25(19-12-8-5-9-13-19)24(31)18-10-6-4-7-11-18/h4-15,25H,16-17H2,1-3H3 |
| InChIKey | HUEDUNJJBRPJEE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 129.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze (2-oxo-1,2-diphenylethyl) 4-[(2,6-dimethoxy-3-pyridinyl)-methylsulfonylamino]-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1,2-diphenylethyl) 4-[(2,6-dimethoxy-3-pyridinyl)-methylsulfonylamino]-4-oxobutanoate?
The IUPAC name of (2-oxo-1,2-diphenylethyl) 4-[(2,6-dimethoxy-3-pyridinyl)-methylsulfonylamino]-4-oxobutanoate (CID 5161036) is (2-oxo-1,2-diphenylethyl) 4-[(2,6-dimethoxy-3-pyridinyl)-methylsulfonylamino]-4-oxobutanoate.
What is the SMILES notation for (2-oxo-1,2-diphenylethyl) 4-[(2,6-dimethoxy-3-pyridinyl)-methylsulfonylamino]-4-oxobutanoate?
The canonical SMILES for (2-oxo-1,2-diphenylethyl) 4-[(2,6-dimethoxy-3-pyridinyl)-methylsulfonylamino]-4-oxobutanoate is COc1ccc(N(C(=O)CCC(=O)OC(C(=O)c2ccccc2)c2ccccc2)S(C)(=O)=O)c(OC)n1.
What is the InChIKey of (2-oxo-1,2-diphenylethyl) 4-[(2,6-dimethoxy-3-pyridinyl)-methylsulfonylamino]-4-oxobutanoate?
The InChIKey is HUEDUNJJBRPJEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26N2O8S/c1-34-21-15-14-20(26(27-21)35-2)28(37(3,32)33)22(29)16-17-23(30)36-25(19-12-8-5-9-13-19)24(31)18-10-6-4-7-11-18/h4-15,25H,16-17H2,1-3H3.
What are the key properties of (2-oxo-1,2-diphenylethyl) 4-[(2,6-dimethoxy-3-pyridinyl)-methylsulfonylamino]-4-oxobutanoate?
(2-oxo-1,2-diphenylethyl) 4-[(2,6-dimethoxy-3-pyridinyl)-methylsulfonylamino]-4-oxobutanoate has a molecular weight of 526.57 g/mol, XLogP of 3.34, 11 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1,2-diphenylethyl) 4-[(2,6-dimethoxy-3-pyridinyl)-methylsulfonylamino]-4-oxobutanoate is sourced from PubChem (CID 5161036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).