About (2S,3S)-2,3-dimethylpiperazine
(2S,3S)-2,3-dimethylpiperazine (PubChem CID 51614849) has the molecular formula C6H14N2
and a molecular weight of 114.19 g/mol. Its IUPAC name is (2S,3S)-2,3-dimethylpiperazine.
Molecular Properties
| Compound Name | (2S,3S)-2,3-dimethylpiperazine |
| PubChem CID | 51614849 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | (2S,3S)-2,3-dimethylpiperazine |
| SMILES | C[C@@H]1NCCN[C@H]1C |
| InChI | InChI=1S/C6H14N2/c1-5-6(2)8-4-3-7-5/h5-8H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | COWPTMLRSANSMQ-WDSKDSINSA-N |
| XLogP | -0.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,3S)-2,3-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2,3-dimethylpiperazine?
The IUPAC name of (2S,3S)-2,3-dimethylpiperazine (CID 51614849) is (2S,3S)-2,3-dimethylpiperazine.
What is the SMILES notation for (2S,3S)-2,3-dimethylpiperazine?
The canonical SMILES for (2S,3S)-2,3-dimethylpiperazine is C[C@@H]1NCCN[C@H]1C.
What is the InChIKey of (2S,3S)-2,3-dimethylpiperazine?
The InChIKey is COWPTMLRSANSMQ-WDSKDSINSA-N. The full InChI is InChI=1S/C6H14N2/c1-5-6(2)8-4-3-7-5/h5-8H,3-4H2,1-2H3/t5-,6-/m0/s1.
What are the key properties of (2S,3S)-2,3-dimethylpiperazine?
(2S,3S)-2,3-dimethylpiperazine has a molecular weight of 114.19 g/mol, XLogP of -0.04, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2,3-dimethylpiperazine is sourced from PubChem (CID 51614849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).