C29H31N3O3 — CID 5161508
2-[[2-(2,3-dimethylphenoxy)acetyl]amino]-N-[(4-phenylcyclohexylidene)amino]benzamide (PubChem CID 5161508) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is 2-[[2-(2,3-dimethylphenoxy)acetyl]amino]-N-[(4-phenylcyclohexylidene)amino]benzamide.
| Compound Name | 2-[[2-(2,3-dimethylphenoxy)acetyl]amino]-N-[(4-phenylcyclohexylidene)amino]benzamide |
|---|---|
| PubChem CID | 5161508 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 2-[[2-(2,3-dimethylphenoxy)acetyl]amino]-N-[(4-phenylcyclohexylidene)amino]benzamide |
| SMILES | Cc1cccc(OCC(=O)Nc2ccccc2C(=O)NN=C2CCC(c3ccccc3)CC2)c1C |
| InChI | InChI=1S/C29H31N3O3/c1-20-9-8-14-27(21(20)2)35-19-28(33)30-26-13-7-6-12-25(26)29(34)32-31-24-17-15-23(16-18-24)22-10-4-3-5-11-22/h3-14,23H,15-19H2,1-2H3,(H,30,33)(H,32,34)/b31-24- |
| InChIKey | YCIBJEDKZWTBIL-QLTSDVKISA-N |
| XLogP | 5.76 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|