C11H11IN4O — CID 51616225
(1R,5R)-3-iodo-1,8,8-trimethyl-6-oxo-2,7-diazabicyclo[3.2.1]oct-3-ene-4,5-dicarbonitrile (PubChem CID 51616225) has the molecular formula C11H11IN4O and a molecular weight of 342.14 g/mol. Its IUPAC name is (1R,5R)-3-iodo-1,8,8-trimethyl-6-oxo-2,7-diazabicyclo[3.2.1]oct-3-ene-4,5-dicarbonitrile.
| Compound Name | (1R,5R)-3-iodo-1,8,8-trimethyl-6-oxo-2,7-diazabicyclo[3.2.1]oct-3-ene-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 51616225 |
| Molecular Formula | C11H11IN4O |
| Molecular Weight | 342.14 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | (1R,5R)-3-iodo-1,8,8-trimethyl-6-oxo-2,7-diazabicyclo[3.2.1]oct-3-ene-4,5-dicarbonitrile |
| SMILES | CC1(C)[C@]2(C)NC(=O)[C@@]1(C#N)C(C#N)=C(I)N2 |
| InChI | InChI=1S/C11H11IN4O/c1-9(2)10(3)15-7(12)6(4-13)11(9,5-14)8(17)16-10/h15H,1-3H3,(H,16,17)/t10-,11+/m0/s1 |
| InChIKey | CVZCGHPLDNFUIJ-WDEREUQCSA-N |
| XLogP | 1.14 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.14 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|