About pyridine-2,6-dicarbothioamide
pyridine-2,6-dicarbothioamide (PubChem CID 5161703) has the molecular formula C7H7N3S2
and a molecular weight of 197.29 g/mol. Its IUPAC name is pyridine-2,6-dicarbothioamide.
Molecular Properties
| Compound Name | pyridine-2,6-dicarbothioamide |
| PubChem CID | 5161703 |
| Molecular Formula | C7H7N3S2 |
| Molecular Weight | 197.29 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | pyridine-2,6-dicarbothioamide |
| SMILES | NC(=S)c1cccc(C(N)=S)n1 |
| InChI | InChI=1S/C7H7N3S2/c8-6(11)4-2-1-3-5(10-4)7(9)12/h1-3H,(H2,8,11)(H2,9,12) |
| InChIKey | GTGKXQDPPFSLQO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.29 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze pyridine-2,6-dicarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-2,6-dicarbothioamide?
The IUPAC name of pyridine-2,6-dicarbothioamide (CID 5161703) is pyridine-2,6-dicarbothioamide.
What is the SMILES notation for pyridine-2,6-dicarbothioamide?
The canonical SMILES for pyridine-2,6-dicarbothioamide is NC(=S)c1cccc(C(N)=S)n1.
What is the InChIKey of pyridine-2,6-dicarbothioamide?
The InChIKey is GTGKXQDPPFSLQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3S2/c8-6(11)4-2-1-3-5(10-4)7(9)12/h1-3H,(H2,8,11)(H2,9,12).
What are the key properties of pyridine-2,6-dicarbothioamide?
pyridine-2,6-dicarbothioamide has a molecular weight of 197.29 g/mol, XLogP of 0.35, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-2,6-dicarbothioamide is sourced from PubChem (CID 5161703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).