C20H30N8O2S2 — CID 51618605
1-cyclohexyl-3-[[2-[[5-(1-methylpyrazol-3-yl)-4-[[(2S)-oxolan-2-yl]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiourea (PubChem CID 51618605) has the molecular formula C20H30N8O2S2 and a molecular weight of 478.65 g/mol. Its IUPAC name is 1-cyclohexyl-3-[[2-[[5-(1-methylpyrazol-3-yl)-4-[[(2S)-oxolan-2-yl]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiourea.
| Compound Name | 1-cyclohexyl-3-[[2-[[5-(1-methylpyrazol-3-yl)-4-[[(2S)-oxolan-2-yl]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiourea |
|---|---|
| PubChem CID | 51618605 |
| Molecular Formula | C20H30N8O2S2 |
| Molecular Weight | 478.65 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 1-cyclohexyl-3-[[2-[[5-(1-methylpyrazol-3-yl)-4-[[(2S)-oxolan-2-yl]methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]thiourea |
| SMILES | Cn1ccc(-c2nnc(SCC(=O)NNC(=S)NC3CCCCC3)n2C[C@@H]2CCCO2)n1 |
| InChI | InChI=1S/C20H30N8O2S2/c1-27-10-9-16(26-27)18-23-25-20(28(18)12-15-8-5-11-30-15)32-13-17(29)22-24-19(31)21-14-6-3-2-4-7-14/h9-10,14-15H,2-8,11-13H2,1H3,(H,22,29)(H2,21,24,31)/t15-/m0/s1 |
| InChIKey | ONBSHOXUWUFPPY-HNNXBMFYSA-N |
| XLogP | 1.78 |
| TPSA | 110.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.65 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|