About (5,7-dichloro-2-methylquinolin-8-yl) 2-chloro-4,5-difluorobenzoate
(5,7-dichloro-2-methylquinolin-8-yl) 2-chloro-4,5-difluorobenzoate (PubChem CID 5162036) has the molecular formula C17H8Cl3F2NO2
and a molecular weight of 402.61 g/mol. Its IUPAC name is (5,7-dichloro-2-methylquinolin-8-yl) 2-chloro-4,5-difluorobenzoate.
Molecular Properties
| Compound Name | (5,7-dichloro-2-methylquinolin-8-yl) 2-chloro-4,5-difluorobenzoate |
| PubChem CID | 5162036 |
| Molecular Formula | C17H8Cl3F2NO2 |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 400.96 |
| IUPAC Name | (5,7-dichloro-2-methylquinolin-8-yl) 2-chloro-4,5-difluorobenzoate |
| SMILES | Cc1ccc2c(Cl)cc(Cl)c(OC(=O)c3cc(F)c(F)cc3Cl)c2n1 |
| InChI | InChI=1S/C17H8Cl3F2NO2/c1-7-2-3-8-10(18)5-12(20)16(15(8)23-7)25-17(24)9-4-13(21)14(22)6-11(9)19/h2-6H,1H3 |
| InChIKey | KIRGHJYZUJCYLH-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (5,7-dichloro-2-methylquinolin-8-yl) 2-chloro-4,5-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,7-dichloro-2-methylquinolin-8-yl) 2-chloro-4,5-difluorobenzoate?
The IUPAC name of (5,7-dichloro-2-methylquinolin-8-yl) 2-chloro-4,5-difluorobenzoate (CID 5162036) is (5,7-dichloro-2-methylquinolin-8-yl) 2-chloro-4,5-difluorobenzoate.
What is the SMILES notation for (5,7-dichloro-2-methylquinolin-8-yl) 2-chloro-4,5-difluorobenzoate?
The canonical SMILES for (5,7-dichloro-2-methylquinolin-8-yl) 2-chloro-4,5-difluorobenzoate is Cc1ccc2c(Cl)cc(Cl)c(OC(=O)c3cc(F)c(F)cc3Cl)c2n1.
What is the InChIKey of (5,7-dichloro-2-methylquinolin-8-yl) 2-chloro-4,5-difluorobenzoate?
The InChIKey is KIRGHJYZUJCYLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H8Cl3F2NO2/c1-7-2-3-8-10(18)5-12(20)16(15(8)23-7)25-17(24)9-4-13(21)14(22)6-11(9)19/h2-6H,1H3.
What are the key properties of (5,7-dichloro-2-methylquinolin-8-yl) 2-chloro-4,5-difluorobenzoate?
(5,7-dichloro-2-methylquinolin-8-yl) 2-chloro-4,5-difluorobenzoate has a molecular weight of 402.61 g/mol, XLogP of 6.00, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5,7-dichloro-2-methylquinolin-8-yl) 2-chloro-4,5-difluorobenzoate is sourced from PubChem (CID 5162036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).