C18H36N2OS — CID 51622716
(2S)-1-(4-ethylpiperazin-1-yl)-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]oxypropane-2-thiol (PubChem CID 51622716) has the molecular formula C18H36N2OS and a molecular weight of 328.57 g/mol. Its IUPAC name is (2S)-1-(4-ethylpiperazin-1-yl)-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]oxypropane-2-thiol.
| Compound Name | (2S)-1-(4-ethylpiperazin-1-yl)-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]oxypropane-2-thiol |
|---|---|
| PubChem CID | 51622716 |
| Molecular Formula | C18H36N2OS |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | (2S)-1-(4-ethylpiperazin-1-yl)-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]oxypropane-2-thiol |
| SMILES | CCN1CCN(C[C@H](S)CO[C@@H]2C[C@H](C)CC(C)(C)C2)CC1 |
| InChI | InChI=1S/C18H36N2OS/c1-5-19-6-8-20(9-7-19)13-17(22)14-21-16-10-15(2)11-18(3,4)12-16/h15-17,22H,5-14H2,1-4H3/t15-,16+,17-/m0/s1 |
| InChIKey | MHXZIESENXBTBB-BBWFWOEESA-N |
| XLogP | 3.15 |
| TPSA | 15.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|