C36H46F4N4O3 — CID 516251
(2R,3R)-2-[(3S,4S)-3-[[4-[1-ethyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]pyrazol-5-yl]piperidin-1-yl]methyl]-4-(3-fluorophenyl)pyrrolidin-1-yl]-3-methylpentanoic acid (PubChem CID 516251) has the molecular formula C36H46F4N4O3 and a molecular weight of 658.78 g/mol. Its IUPAC name is (2R,3R)-2-[(3S,4S)-3-[[4-[1-ethyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]pyrazol-5-yl]piperidin-1-yl]methyl]-4-(3-fluorophenyl)pyrrolidin-1-yl]-3-methylpentanoic acid.
| Compound Name | (2R,3R)-2-[(3S,4S)-3-[[4-[1-ethyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]pyrazol-5-yl]piperidin-1-yl]methyl]-4-(3-fluorophenyl)pyrrolidin-1-yl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 516251 |
| Molecular Formula | C36H46F4N4O3 |
| Molecular Weight | 658.78 g/mol |
| Exact Mass | 658.35 |
| IUPAC Name | (2R,3R)-2-[(3S,4S)-3-[[4-[1-ethyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]pyrazol-5-yl]piperidin-1-yl]methyl]-4-(3-fluorophenyl)pyrrolidin-1-yl]-3-methylpentanoic acid |
| SMILES | CC[C@@H](C)[C@H](C(=O)O)N1C[C@H](CN2CCC(c3cc(Cc4ccc(OCC(F)(F)F)cc4)nn3CC)CC2)[C@@H](c2cccc(F)c2)C1 |
| InChI | InChI=1S/C36H46F4N4O3/c1-4-24(3)34(35(45)46)43-21-28(32(22-43)27-7-6-8-29(37)18-27)20-42-15-13-26(14-16-42)33-19-30(41-44(33)5-2)17-25-9-11-31(12-10-25)47-23-36(38,39)40/h6-12,18-19,24,26,28,32,34H,4-5,13-17,20-23H2,1-3H3,(H,45,46)/t24-,28+,32-,34-/m1/s1 |
| InChIKey | BYGHXMKCHHHFAS-RKCOTYCJSA-N |
| XLogP | 6.97 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.78 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |