C21H27FN2O — CID 51628113
1-[(2R)-1-ethylpyrrolidin-2-yl]-N-[[3-[(2-fluorophenyl)methoxy]phenyl]methyl]methanamine (PubChem CID 51628113) has the molecular formula C21H27FN2O and a molecular weight of 342.46 g/mol. Its IUPAC name is 1-[(2R)-1-ethylpyrrolidin-2-yl]-N-[[3-[(2-fluorophenyl)methoxy]phenyl]methyl]methanamine.
| Compound Name | 1-[(2R)-1-ethylpyrrolidin-2-yl]-N-[[3-[(2-fluorophenyl)methoxy]phenyl]methyl]methanamine |
|---|---|
| PubChem CID | 51628113 |
| Molecular Formula | C21H27FN2O |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 1-[(2R)-1-ethylpyrrolidin-2-yl]-N-[[3-[(2-fluorophenyl)methoxy]phenyl]methyl]methanamine |
| SMILES | CCN1CCC[C@@H]1CNCc1cccc(OCc2ccccc2F)c1 |
| InChI | InChI=1S/C21H27FN2O/c1-2-24-12-6-9-19(24)15-23-14-17-7-5-10-20(13-17)25-16-18-8-3-4-11-21(18)22/h3-5,7-8,10-11,13,19,23H,2,6,9,12,14-16H2,1H3/t19-/m1/s1 |
| InChIKey | TZDVURWZABRVEY-LJQANCHMSA-N |
| XLogP | 3.98 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |