C21H27FN2O2 — CID 51635847
2-[(2S)-1-[(4-fluorophenyl)methyl]-4-[(4-methoxyphenyl)methyl]piperazin-2-yl]ethanol (PubChem CID 51635847) has the molecular formula C21H27FN2O2 and a molecular weight of 358.46 g/mol. Its IUPAC name is 2-[(2S)-1-[(4-fluorophenyl)methyl]-4-[(4-methoxyphenyl)methyl]piperazin-2-yl]ethanol.
| Compound Name | 2-[(2S)-1-[(4-fluorophenyl)methyl]-4-[(4-methoxyphenyl)methyl]piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 51635847 |
| Molecular Formula | C21H27FN2O2 |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 2-[(2S)-1-[(4-fluorophenyl)methyl]-4-[(4-methoxyphenyl)methyl]piperazin-2-yl]ethanol |
| SMILES | COc1ccc(CN2CCN(Cc3ccc(F)cc3)[C@@H](CCO)C2)cc1 |
| InChI | InChI=1S/C21H27FN2O2/c1-26-21-8-4-17(5-9-21)14-23-11-12-24(20(16-23)10-13-25)15-18-2-6-19(22)7-3-18/h2-9,20,25H,10-16H2,1H3/t20-/m0/s1 |
| InChIKey | JHIWJMNCWUARQC-FQEVSTJZSA-N |
| XLogP | 2.90 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |