C20H34N2 — CID 51637592
(1S,8aR)-2-[[(1R)-cyclohex-3-en-1-yl]methyl]-1-cyclohexyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 51637592) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is (1S,8aR)-2-[[(1R)-cyclohex-3-en-1-yl]methyl]-1-cyclohexyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (1S,8aR)-2-[[(1R)-cyclohex-3-en-1-yl]methyl]-1-cyclohexyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 51637592 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | (1S,8aR)-2-[[(1R)-cyclohex-3-en-1-yl]methyl]-1-cyclohexyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | C1=CC[C@H](CN2CCN3CCC[C@@H]3[C@@H]2C2CCCCC2)CC1 |
| InChI | InChI=1S/C20H34N2/c1-3-8-17(9-4-1)16-22-15-14-21-13-7-12-19(21)20(22)18-10-5-2-6-11-18/h1,3,17-20H,2,4-16H2/t17-,19+,20-/m0/s1 |
| InChIKey | SREOCUTYLOXMPK-SXLOBPIMSA-N |
| XLogP | 4.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|