About 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane
1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane (PubChem CID 5163842) has the molecular formula C13H20O4
and a molecular weight of 240.30 g/mol. Its IUPAC name is 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane.
Molecular Properties
| Compound Name | 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane |
| PubChem CID | 5163842 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane |
| SMILES | C=COCC(COC=C)(COC=C)COC=C |
| InChI | InChI=1S/C13H20O4/c1-5-14-9-13(10-15-6-2,11-16-7-3)12-17-8-4/h5-8H,1-4,9-12H2 |
| InChIKey | XDWRKTULOHXYGN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane?
The IUPAC name of 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane (CID 5163842) is 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane.
What is the SMILES notation for 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane?
The canonical SMILES for 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane is C=COCC(COC=C)(COC=C)COC=C.
What is the InChIKey of 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane?
The InChIKey is XDWRKTULOHXYGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O4/c1-5-14-9-13(10-15-6-2,11-16-7-3)12-17-8-4/h5-8H,1-4,9-12H2.
What are the key properties of 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane?
1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane has a molecular weight of 240.30 g/mol, XLogP of 2.61, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(ethenoxy)-2,2-bis(ethenoxymethyl)propane is sourced from PubChem (CID 5163842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).