C17H20FN2O4P — CID 5163960
2-amino-5-diethoxyphosphoryl-4-(4-fluorophenyl)-6-methyl-4H-pyran-3-carbonitrile (PubChem CID 5163960) has the molecular formula C17H20FN2O4P and a molecular weight of 366.33 g/mol. Its IUPAC name is 2-amino-5-diethoxyphosphoryl-4-(4-fluorophenyl)-6-methyl-4H-pyran-3-carbonitrile.
| Compound Name | 2-amino-5-diethoxyphosphoryl-4-(4-fluorophenyl)-6-methyl-4H-pyran-3-carbonitrile |
|---|---|
| PubChem CID | 5163960 |
| Molecular Formula | C17H20FN2O4P |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 2-amino-5-diethoxyphosphoryl-4-(4-fluorophenyl)-6-methyl-4H-pyran-3-carbonitrile |
| SMILES | CCOP(=O)(OCC)C1=C(C)OC(N)=C(C#N)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H20FN2O4P/c1-4-22-25(21,23-5-2)16-11(3)24-17(20)14(10-19)15(16)12-6-8-13(18)9-7-12/h6-9,15H,4-5,20H2,1-3H3 |
| InChIKey | PHPBBKCVZXNXRR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|