About 1-methyl-3-(1,2,5-thiadiazol-3-yl)urea
1-methyl-3-(1,2,5-thiadiazol-3-yl)urea (PubChem CID 5164106) has the molecular formula C4H6N4OS
and a molecular weight of 158.19 g/mol. Its IUPAC name is 1-methyl-3-(1,2,5-thiadiazol-3-yl)urea.
Molecular Properties
| Compound Name | 1-methyl-3-(1,2,5-thiadiazol-3-yl)urea |
| PubChem CID | 5164106 |
| Molecular Formula | C4H6N4OS |
| Molecular Weight | 158.19 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | 1-methyl-3-(1,2,5-thiadiazol-3-yl)urea |
| SMILES | CNC(=O)Nc1cnsn1 |
| InChI | InChI=1S/C4H6N4OS/c1-5-4(9)7-3-2-6-10-8-3/h2H,1H3,(H2,5,7,8,9) |
| InChIKey | PUMBMSSHODUYQZ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.19 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-3-(1,2,5-thiadiazol-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(1,2,5-thiadiazol-3-yl)urea?
The IUPAC name of 1-methyl-3-(1,2,5-thiadiazol-3-yl)urea (CID 5164106) is 1-methyl-3-(1,2,5-thiadiazol-3-yl)urea.
What is the SMILES notation for 1-methyl-3-(1,2,5-thiadiazol-3-yl)urea?
The canonical SMILES for 1-methyl-3-(1,2,5-thiadiazol-3-yl)urea is CNC(=O)Nc1cnsn1.
What is the InChIKey of 1-methyl-3-(1,2,5-thiadiazol-3-yl)urea?
The InChIKey is PUMBMSSHODUYQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4OS/c1-5-4(9)7-3-2-6-10-8-3/h2H,1H3,(H2,5,7,8,9).
What are the key properties of 1-methyl-3-(1,2,5-thiadiazol-3-yl)urea?
1-methyl-3-(1,2,5-thiadiazol-3-yl)urea has a molecular weight of 158.19 g/mol, XLogP of 0.29, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(1,2,5-thiadiazol-3-yl)urea is sourced from PubChem (CID 5164106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).