C24H26F3N5O3 — CID 5164302
5-(3,4-dimethoxyphenyl)-N-methyl-N-(2-pyridin-2-ylethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 5164302) has the molecular formula C24H26F3N5O3 and a molecular weight of 489.50 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-N-methyl-N-(2-pyridin-2-ylethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 5-(3,4-dimethoxyphenyl)-N-methyl-N-(2-pyridin-2-ylethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 5164302 |
| Molecular Formula | C24H26F3N5O3 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-N-methyl-N-(2-pyridin-2-ylethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | COc1ccc(C2CC(C(F)(F)F)n3ncc(C(=O)N(C)CCc4ccccn4)c3N2)cc1OC |
| InChI | InChI=1S/C24H26F3N5O3/c1-31(11-9-16-6-4-5-10-28-16)23(33)17-14-29-32-21(24(25,26)27)13-18(30-22(17)32)15-7-8-19(34-2)20(12-15)35-3/h4-8,10,12,14,18,21,30H,9,11,13H2,1-3H3 |
| InChIKey | KONZTNHQEOKCAJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |